C17H20N4O6S — CID 19510929
propan-2-yl 2-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19510929) has the molecular formula C17H20N4O6S and a molecular weight of 408.44 g/mol. Its IUPAC name is propan-2-yl 2-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19510929 |
| Molecular Formula | C17H20N4O6S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | propan-2-yl 2-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COc1n[nH]c(C(=O)Nc2sc3c(c2C(=O)OC(C)C)CCCC3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N4O6S/c1-8(2)27-17(23)11-9-6-4-5-7-10(9)28-16(11)18-14(22)12-13(21(24)25)15(26-3)20-19-12/h8H,4-7H2,1-3H3,(H,18,22)(H,19,20) |
| InChIKey | PTHOQCAWIGYEEI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|