C23H24N2O9S — CID 16958719
1-O-methyl 3-O-[2-oxo-2-[(3-propan-2-yloxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]ethyl] 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 16958719) has the molecular formula C23H24N2O9S and a molecular weight of 504.52 g/mol. Its IUPAC name is 1-O-methyl 3-O-[2-oxo-2-[(3-propan-2-yloxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]ethyl] 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-[2-oxo-2-[(3-propan-2-yloxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]ethyl] 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 16958719 |
| Molecular Formula | C23H24N2O9S |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-O-methyl 3-O-[2-oxo-2-[(3-propan-2-yloxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]ethyl] 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCC(=O)Nc2sc3c(c2C(=O)OC(C)C)CCCC3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H24N2O9S/c1-12(2)34-23(29)19-16-6-4-5-7-17(16)35-20(19)24-18(26)11-33-22(28)14-8-13(21(27)32-3)9-15(10-14)25(30)31/h8-10,12H,4-7,11H2,1-3H3,(H,24,26) |
| InChIKey | ZOYSGSZXWFCWRC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|