C16H18N4O5S — CID 135803057
propan-2-yl 2-[(5-nitro-1H-pyrazole-3-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 135803057) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is propan-2-yl 2-[(5-nitro-1H-pyrazole-3-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[(5-nitro-1H-pyrazole-3-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135803057 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | propan-2-yl 2-[(5-nitro-1H-pyrazole-3-carbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])[nH]n2)sc2c1CCCC2 |
| InChI | InChI=1S/C16H18N4O5S/c1-8(2)25-16(22)13-9-5-3-4-6-11(9)26-15(13)17-14(21)10-7-12(19-18-10)20(23)24/h7-8H,3-6H2,1-2H3,(H,17,21)(H,18,19) |
| InChIKey | JMLSTWKOWNZOAW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|