C11H11BrN4O4S — CID 19465140
5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(2-sulfanylethyl)furan-2-carboxamide (PubChem CID 19465140) has the molecular formula C11H11BrN4O4S and a molecular weight of 375.20 g/mol. Its IUPAC name is 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(2-sulfanylethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(2-sulfanylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19465140 |
| Molecular Formula | C11H11BrN4O4S |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(2-sulfanylethyl)furan-2-carboxamide |
| SMILES | O=C(NCCS)c1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1 |
| InChI | InChI=1S/C11H11BrN4O4S/c12-8-6-15(14-10(8)16(18)19)5-7-1-2-9(20-7)11(17)13-3-4-21/h1-2,6,21H,3-5H2,(H,13,17) |
| InChIKey | JPTCXFFVYJWXDC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|