C12H11BrN4O6 — CID 19465211
methyl 2-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]acetate (PubChem CID 19465211) has the molecular formula C12H11BrN4O6 and a molecular weight of 387.15 g/mol. Its IUPAC name is methyl 2-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 19465211 |
| Molecular Formula | C12H11BrN4O6 |
| Molecular Weight | 387.15 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | methyl 2-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1 |
| InChI | InChI=1S/C12H11BrN4O6/c1-22-10(18)4-14-12(19)9-3-2-7(23-9)5-16-6-8(13)11(15-16)17(20)21/h2-3,6H,4-5H2,1H3,(H,14,19) |
| InChIKey | WFCVMUYIISSGGX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.15 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|