C20H17BrN6O4 — CID 19465212
5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]furan-2-carboxamide (PubChem CID 19465212) has the molecular formula C20H17BrN6O4 and a molecular weight of 485.30 g/mol. Its IUPAC name is 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19465212 |
| Molecular Formula | C20H17BrN6O4 |
| Molecular Weight | 485.30 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]furan-2-carboxamide |
| SMILES | Cc1cccc(Cn2cc(NC(=O)c3ccc(Cn4cc(Br)c([N+](=O)[O-])n4)o3)cn2)c1 |
| InChI | InChI=1S/C20H17BrN6O4/c1-13-3-2-4-14(7-13)9-25-10-15(8-22-25)23-20(28)18-6-5-16(31-18)11-26-12-17(21)19(24-26)27(29)30/h2-8,10,12H,9,11H2,1H3,(H,23,28) |
| InChIKey | YWDRDCVBSMYRPG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|