C15H7BrF4N4O4 — CID 19463436
5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide (PubChem CID 19463436) has the molecular formula C15H7BrF4N4O4 and a molecular weight of 463.14 g/mol. Its IUPAC name is 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19463436 |
| Molecular Formula | C15H7BrF4N4O4 |
| Molecular Weight | 463.14 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-(2,3,5,6-tetrafluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)c1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1 |
| InChI | InChI=1S/C15H7BrF4N4O4/c16-7-5-23(22-14(7)24(26)27)4-6-1-2-10(28-6)15(25)21-13-11(19)8(17)3-9(18)12(13)20/h1-3,5H,4H2,(H,21,25) |
| InChIKey | SRMXGLWUQHTQER-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.14 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|