C20H21BrN6O6S — CID 2956755
1-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea (PubChem CID 2956755) has the molecular formula C20H21BrN6O6S and a molecular weight of 553.40 g/mol. Its IUPAC name is 1-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 2956755 |
| Molecular Formula | C20H21BrN6O6S |
| Molecular Weight | 553.40 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | 1-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)NNC(=O)c2ccc(Cn3cc(Br)c([N+](=O)[O-])n3)o2)cc1OC |
| InChI | InChI=1S/C20H21BrN6O6S/c1-31-15-5-3-12(9-17(15)32-2)7-8-22-20(34)24-23-19(28)16-6-4-13(33-16)10-26-11-14(21)18(25-26)27(29)30/h3-6,9,11H,7-8,10H2,1-2H3,(H,23,28)(H2,22,24,34) |
| InChIKey | PSPHBXSODHBVKL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|