C22H25BrN4O4 — CID 19465138
5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-(4-butan-2-ylphenyl)propyl]furan-2-carboxamide (PubChem CID 19465138) has the molecular formula C22H25BrN4O4 and a molecular weight of 489.37 g/mol. Its IUPAC name is 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-(4-butan-2-ylphenyl)propyl]furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-(4-butan-2-ylphenyl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19465138 |
| Molecular Formula | C22H25BrN4O4 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-(4-butan-2-ylphenyl)propyl]furan-2-carboxamide |
| SMILES | CCC(C)c1ccc(C(CC)NC(=O)c2ccc(Cn3cc(Br)c([N+](=O)[O-])n3)o2)cc1 |
| InChI | InChI=1S/C22H25BrN4O4/c1-4-14(3)15-6-8-16(9-7-15)19(5-2)24-22(28)20-11-10-17(31-20)12-26-13-18(23)21(25-26)27(29)30/h6-11,13-14,19H,4-5,12H2,1-3H3,(H,24,28) |
| InChIKey | ZRNGDMOPGXXCEB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|