C17H14F4N4O4S — CID 19449260
5,7-bis(difluoromethyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19449260) has the molecular formula C17H14F4N4O4S and a molecular weight of 446.38 g/mol. Its IUPAC name is 5,7-bis(difluoromethyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5,7-bis(difluoromethyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19449260 |
| Molecular Formula | C17H14F4N4O4S |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 5,7-bis(difluoromethyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2cc3nc(C(F)F)cc(C(F)F)n3n2)c1 |
| InChI | InChI=1S/C17H14F4N4O4S/c1-2-30(28,29)8-3-4-13(26)9(5-8)23-17(27)11-7-14-22-10(15(18)19)6-12(16(20)21)25(14)24-11/h3-7,15-16,26H,2H2,1H3,(H,23,27) |
| InChIKey | DNJSBXCKDHHHPF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|