C15H9F4N5O3 — CID 19449179
5,7-bis(difluoromethyl)-N-(2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19449179) has the molecular formula C15H9F4N5O3 and a molecular weight of 383.26 g/mol. Its IUPAC name is 5,7-bis(difluoromethyl)-N-(2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5,7-bis(difluoromethyl)-N-(2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19449179 |
| Molecular Formula | C15H9F4N5O3 |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 5,7-bis(difluoromethyl)-N-(2-nitrophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])c1cc2nc(C(F)F)cc(C(F)F)n2n1 |
| InChI | InChI=1S/C15H9F4N5O3/c16-13(17)8-5-11(14(18)19)23-12(20-8)6-9(22-23)15(25)21-7-3-1-2-4-10(7)24(26)27/h1-6,13-14H,(H,21,25) |
| InChIKey | YAXCEFKZSZDYHD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|