C15H6F8N4O — CID 19447537
5,7-bis(difluoromethyl)-N-(2,3,5,6-tetrafluorophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19447537) has the molecular formula C15H6F8N4O and a molecular weight of 410.22 g/mol. Its IUPAC name is 5,7-bis(difluoromethyl)-N-(2,3,5,6-tetrafluorophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5,7-bis(difluoromethyl)-N-(2,3,5,6-tetrafluorophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19447537 |
| Molecular Formula | C15H6F8N4O |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 5,7-bis(difluoromethyl)-N-(2,3,5,6-tetrafluorophenyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)c1cc2nc(C(F)F)cc(C(F)F)n2n1 |
| InChI | InChI=1S/C15H6F8N4O/c16-4-1-5(17)11(19)12(10(4)18)25-15(28)7-3-9-24-6(13(20)21)2-8(14(22)23)27(9)26-7/h1-3,13-14H,(H,25,28) |
| InChIKey | JDGUTAAYSVVIJG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|