C18H13F7N4O — CID 19466160
5-tert-butyl-N-(2,3,5,6-tetrafluorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19466160) has the molecular formula C18H13F7N4O and a molecular weight of 434.32 g/mol. Its IUPAC name is 5-tert-butyl-N-(2,3,5,6-tetrafluorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-tert-butyl-N-(2,3,5,6-tetrafluorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19466160 |
| Molecular Formula | C18H13F7N4O |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 5-tert-butyl-N-(2,3,5,6-tetrafluorophenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CC(C)(C)c1cc(C(F)(F)F)n2nc(C(=O)Nc3c(F)c(F)cc(F)c3F)cc2n1 |
| InChI | InChI=1S/C18H13F7N4O/c1-17(2,3)10-6-11(18(23,24)25)29-12(26-10)5-9(28-29)16(30)27-15-13(21)7(19)4-8(20)14(15)22/h4-6H,1-3H3,(H,27,30) |
| InChIKey | POXIIZWJSDGPQJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|