C18H16ClNO5S — CID 31618564
5-chloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 31618564) has the molecular formula C18H16ClNO5S and a molecular weight of 393.85 g/mol. Its IUPAC name is 5-chloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 31618564 |
| Molecular Formula | C18H16ClNO5S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 5-chloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2oc3ccc(Cl)cc3c2C)c1 |
| InChI | InChI=1S/C18H16ClNO5S/c1-3-26(23,24)12-5-6-15(21)14(9-12)20-18(22)17-10(2)13-8-11(19)4-7-16(13)25-17/h4-9,21H,3H2,1-2H3,(H,20,22) |
| InChIKey | NEBUWWJHBVANQA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|