C17H13ClFNO2 — CID 9344604
N-(4-chloro-2-methylphenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 9344604) has the molecular formula C17H13ClFNO2 and a molecular weight of 317.75 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9344604 |
| Molecular Formula | C17H13ClFNO2 |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C17H13ClFNO2/c1-9-7-11(18)3-5-14(9)20-17(21)16-10(2)13-8-12(19)4-6-15(13)22-16/h3-8H,1-2H3,(H,20,21) |
| InChIKey | XSDPCEBRQYFIFX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |