C18H15ClFNO3 — CID 9344827
N-(4-chloro-2-methoxy-5-methylphenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 9344827) has the molecular formula C18H15ClFNO3 and a molecular weight of 347.77 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9344827 |
| Molecular Formula | C18H15ClFNO3 |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-5-fluoro-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C18H15ClFNO3/c1-9-6-14(16(23-3)8-13(9)19)21-18(22)17-10(2)12-7-11(20)4-5-15(12)24-17/h4-8H,1-3H3,(H,21,22) |
| InChIKey | OOGDLBXCMVNJQL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |