C10H8ClN3O4S — CID 61131080
N-(2-chloro-5-sulfamoylphenyl)-1,2-oxazole-5-carboxamide (PubChem CID 61131080) has the molecular formula C10H8ClN3O4S and a molecular weight of 301.71 g/mol. Its IUPAC name is N-(2-chloro-5-sulfamoylphenyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2-chloro-5-sulfamoylphenyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 61131080 |
| Molecular Formula | C10H8ClN3O4S |
| Molecular Weight | 301.71 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | N-(2-chloro-5-sulfamoylphenyl)-1,2-oxazole-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(NC(=O)c2ccno2)c1 |
| InChI | InChI=1S/C10H8ClN3O4S/c11-7-2-1-6(19(12,16)17)5-8(7)14-10(15)9-3-4-13-18-9/h1-5H,(H,14,15)(H2,12,16,17) |
| InChIKey | DASLDAFYIBGWCN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.71 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |