About 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride
3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride (PubChem CID 66156540) has the molecular formula C11H8ClFN2O4S
and a molecular weight of 318.71 g/mol. Its IUPAC name is 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride |
| PubChem CID | 66156540 |
| Molecular Formula | C11H8ClFN2O4S |
| Molecular Weight | 318.71 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride |
| SMILES | Cc1cc(C(=O)Nc2ccc(S(=O)(=O)Cl)cc2F)no1 |
| InChI | InChI=1S/C11H8ClFN2O4S/c1-6-4-10(15-19-6)11(16)14-9-3-2-7(5-8(9)13)20(12,17)18/h2-5H,1H3,(H,14,16) |
| InChIKey | VZJWCOLMTWDZJK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.71 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride?
The IUPAC name of 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride (CID 66156540) is 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride.
What is the SMILES notation for 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride?
The canonical SMILES for 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride is Cc1cc(C(=O)Nc2ccc(S(=O)(=O)Cl)cc2F)no1.
What is the InChIKey of 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride?
The InChIKey is VZJWCOLMTWDZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClFN2O4S/c1-6-4-10(15-19-6)11(16)14-9-3-2-7(5-8(9)13)20(12,17)18/h2-5H,1H3,(H,14,16).
What are the key properties of 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride?
3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride has a molecular weight of 318.71 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzenesulfonyl chloride is sourced from PubChem (CID 66156540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).