C11H9ClFN3O3S — CID 43101403
3-fluoro-4-[(1-methylpyrazole-4-carbonyl)amino]benzenesulfonyl chloride (PubChem CID 43101403) has the molecular formula C11H9ClFN3O3S and a molecular weight of 317.73 g/mol. Its IUPAC name is 3-fluoro-4-[(1-methylpyrazole-4-carbonyl)amino]benzenesulfonyl chloride.
| Compound Name | 3-fluoro-4-[(1-methylpyrazole-4-carbonyl)amino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43101403 |
| Molecular Formula | C11H9ClFN3O3S |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 3-fluoro-4-[(1-methylpyrazole-4-carbonyl)amino]benzenesulfonyl chloride |
| SMILES | Cn1cc(C(=O)Nc2ccc(S(=O)(=O)Cl)cc2F)cn1 |
| InChI | InChI=1S/C11H9ClFN3O3S/c1-16-6-7(5-14-16)11(17)15-10-3-2-8(4-9(10)13)20(12,18)19/h2-6H,1H3,(H,15,17) |
| InChIKey | HBFBLGBYUZUBFB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |