C17H12F3N3O — CID 141207933
1-methyl-N-[2-(2,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide (PubChem CID 141207933) has the molecular formula C17H12F3N3O and a molecular weight of 331.30 g/mol. Its IUPAC name is 1-methyl-N-[2-(2,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[2-(2,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 141207933 |
| Molecular Formula | C17H12F3N3O |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-methyl-N-[2-(2,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccccc2-c2cc(F)c(F)cc2F)cn1 |
| InChI | InChI=1S/C17H12F3N3O/c1-23-9-10(8-21-23)17(24)22-16-5-3-2-4-11(16)12-6-14(19)15(20)7-13(12)18/h2-9H,1H3,(H,22,24) |
| InChIKey | BDYJQVFGXADEDQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|