C12H14N4O3S — CID 35368634
N-[2-(methanesulfonamido)phenyl]-1-methylpyrazole-4-carboxamide (PubChem CID 35368634) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)phenyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[2-(methanesulfonamido)phenyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 35368634 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-[2-(methanesulfonamido)phenyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccccc2NS(C)(=O)=O)cn1 |
| InChI | InChI=1S/C12H14N4O3S/c1-16-8-9(7-13-16)12(17)14-10-5-3-4-6-11(10)15-20(2,18)19/h3-8,15H,1-2H3,(H,14,17) |
| InChIKey | DESQBMVZQDLRPG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |