C11H9Cl2N3O3S — CID 62920806
3-chloro-4-[(2-methylpyrazole-3-carbonyl)amino]benzenesulfonyl chloride (PubChem CID 62920806) has the molecular formula C11H9Cl2N3O3S and a molecular weight of 334.18 g/mol. Its IUPAC name is 3-chloro-4-[(2-methylpyrazole-3-carbonyl)amino]benzenesulfonyl chloride.
| Compound Name | 3-chloro-4-[(2-methylpyrazole-3-carbonyl)amino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 62920806 |
| Molecular Formula | C11H9Cl2N3O3S |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 3-chloro-4-[(2-methylpyrazole-3-carbonyl)amino]benzenesulfonyl chloride |
| SMILES | Cn1nccc1C(=O)Nc1ccc(S(=O)(=O)Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2N3O3S/c1-16-10(4-5-14-16)11(17)15-9-3-2-7(6-8(9)12)20(13,18)19/h2-6H,1H3,(H,15,17) |
| InChIKey | MKVNWPDGJZFLSB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |