C15H21BrFNO — CID 107592531
N-(5-bromo-4-fluoro-2-methylphenyl)-3,4,4-trimethylpentanamide (PubChem CID 107592531) has the molecular formula C15H21BrFNO and a molecular weight of 330.24 g/mol. Its IUPAC name is N-(5-bromo-4-fluoro-2-methylphenyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(5-bromo-4-fluoro-2-methylphenyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 107592531 |
| Molecular Formula | C15H21BrFNO |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-(5-bromo-4-fluoro-2-methylphenyl)-3,4,4-trimethylpentanamide |
| SMILES | Cc1cc(F)c(Br)cc1NC(=O)CC(C)C(C)(C)C |
| InChI | InChI=1S/C15H21BrFNO/c1-9-6-12(17)11(16)8-13(9)18-14(19)7-10(2)15(3,4)5/h6,8,10H,7H2,1-5H3,(H,18,19) |
| InChIKey | PLCHEUJZSBGQOL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |