C13H21FN2O3S — CID 106115793
3-fluoro-4-[2-(2-hydroxyethyl)pentylamino]benzenesulfonamide (PubChem CID 106115793) has the molecular formula C13H21FN2O3S and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-fluoro-4-[2-(2-hydroxyethyl)pentylamino]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[2-(2-hydroxyethyl)pentylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 106115793 |
| Molecular Formula | C13H21FN2O3S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-fluoro-4-[2-(2-hydroxyethyl)pentylamino]benzenesulfonamide |
| SMILES | CCCC(CCO)CNc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C13H21FN2O3S/c1-2-3-10(6-7-17)9-16-13-5-4-11(8-12(13)14)20(15,18)19/h4-5,8,10,16-17H,2-3,6-7,9H2,1H3,(H2,15,18,19) |
| InChIKey | KQEUBZNOFSDIDH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |