C12H17FN2O4S — CID 82847003
5-(2-fluoro-4-sulfamoylanilino)hexanoic acid (PubChem CID 82847003) has the molecular formula C12H17FN2O4S and a molecular weight of 304.34 g/mol. Its IUPAC name is 5-(2-fluoro-4-sulfamoylanilino)hexanoic acid.
| Compound Name | 5-(2-fluoro-4-sulfamoylanilino)hexanoic acid |
|---|---|
| PubChem CID | 82847003 |
| Molecular Formula | C12H17FN2O4S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-(2-fluoro-4-sulfamoylanilino)hexanoic acid |
| SMILES | CC(CCCC(=O)O)Nc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C12H17FN2O4S/c1-8(3-2-4-12(16)17)15-11-6-5-9(7-10(11)13)20(14,18)19/h5-8,15H,2-4H2,1H3,(H,16,17)(H2,14,18,19) |
| InChIKey | ULUVTXKFJKWCIN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |