C18H15NO3S — CID 926068
naphthalen-1-ylmethyl 2-(thiophene-2-carbonylamino)acetate (PubChem CID 926068) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 2-(thiophene-2-carbonylamino)acetate.
| Compound Name | naphthalen-1-ylmethyl 2-(thiophene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 926068 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | naphthalen-1-ylmethyl 2-(thiophene-2-carbonylamino)acetate |
| SMILES | O=C(CNC(=O)c1cccs1)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C18H15NO3S/c20-17(11-19-18(21)16-9-4-10-23-16)22-12-14-7-3-6-13-5-1-2-8-15(13)14/h1-10H,11-12H2,(H,19,21) |
| InChIKey | HWQCZSJDADRKBM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |