C16H17N3O3S — CID 18154158
N-[2-[(4-acetamidophenyl)methylamino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 18154158) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-[2-[(4-acetamidophenyl)methylamino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[(4-acetamidophenyl)methylamino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18154158 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[2-[(4-acetamidophenyl)methylamino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(CNC(=O)CNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C16H17N3O3S/c1-11(20)19-13-6-4-12(5-7-13)9-17-15(21)10-18-16(22)14-3-2-8-23-14/h2-8H,9-10H2,1H3,(H,17,21)(H,18,22)(H,19,20) |
| InChIKey | MDEQDXGGHBCQEP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |