C22H29FN2O3 — CID 4148902
N-[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]-2,5-dimethyl-N-pentylfuran-3-carboxamide (PubChem CID 4148902) has the molecular formula C22H29FN2O3 and a molecular weight of 388.48 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]-2,5-dimethyl-N-pentylfuran-3-carboxamide.
| Compound Name | N-[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]-2,5-dimethyl-N-pentylfuran-3-carboxamide |
|---|---|
| PubChem CID | 4148902 |
| Molecular Formula | C22H29FN2O3 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]-2,5-dimethyl-N-pentylfuran-3-carboxamide |
| SMILES | CCCCCN(CCC(=O)NCc1ccc(F)cc1)C(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C22H29FN2O3/c1-4-5-6-12-25(22(27)20-14-16(2)28-17(20)3)13-11-21(26)24-15-18-7-9-19(23)10-8-18/h7-10,14H,4-6,11-13,15H2,1-3H3,(H,24,26) |
| InChIKey | ZZHGWTJIZMEYOB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|