C19H22FN3O2S — CID 8942130
1-[(4-fluorophenyl)methyl]-3-[[2-(2,4,6-trimethylphenoxy)acetyl]amino]thiourea (PubChem CID 8942130) has the molecular formula C19H22FN3O2S and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[[2-(2,4,6-trimethylphenoxy)acetyl]amino]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[[2-(2,4,6-trimethylphenoxy)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8942130 |
| Molecular Formula | C19H22FN3O2S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[[2-(2,4,6-trimethylphenoxy)acetyl]amino]thiourea |
| SMILES | Cc1cc(C)c(OCC(=O)NNC(=S)NCc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C19H22FN3O2S/c1-12-8-13(2)18(14(3)9-12)25-11-17(24)22-23-19(26)21-10-15-4-6-16(20)7-5-15/h4-9H,10-11H2,1-3H3,(H,22,24)(H2,21,23,26) |
| InChIKey | BIHVYXBXMLSHEH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|