C18H20FN3OS2 — CID 8942477
1-[[2-(3,4-dimethylphenyl)sulfanylacetyl]amino]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 8942477) has the molecular formula C18H20FN3OS2 and a molecular weight of 377.51 g/mol. Its IUPAC name is 1-[[2-(3,4-dimethylphenyl)sulfanylacetyl]amino]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[[2-(3,4-dimethylphenyl)sulfanylacetyl]amino]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8942477 |
| Molecular Formula | C18H20FN3OS2 |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-[[2-(3,4-dimethylphenyl)sulfanylacetyl]amino]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | Cc1ccc(SCC(=O)NNC(=S)NCc2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C18H20FN3OS2/c1-12-3-8-16(9-13(12)2)25-11-17(23)21-22-18(24)20-10-14-4-6-15(19)7-5-14/h3-9H,10-11H2,1-2H3,(H,21,23)(H2,20,22,24) |
| InChIKey | HFGIQIYHKJGGAJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|