C20H20FN5O2S — CID 8943221
1-[(4-fluorophenyl)methyl]-3-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoylamino]thiourea (PubChem CID 8943221) has the molecular formula C20H20FN5O2S and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoylamino]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoylamino]thiourea |
|---|---|
| PubChem CID | 8943221 |
| Molecular Formula | C20H20FN5O2S |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoylamino]thiourea |
| SMILES | Cc1ccc(-c2nnc(CCC(=O)NNC(=S)NCc3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C20H20FN5O2S/c1-13-2-6-15(7-3-13)19-25-24-18(28-19)11-10-17(27)23-26-20(29)22-12-14-4-8-16(21)9-5-14/h2-9H,10-12H2,1H3,(H,23,27)(H2,22,26,29) |
| InChIKey | DYNQFQSGSSMKMI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|