C18H23N5O2S — CID 9090178
1-cyclopentyl-3-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoylamino]thiourea (PubChem CID 9090178) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-cyclopentyl-3-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoylamino]thiourea.
| Compound Name | 1-cyclopentyl-3-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoylamino]thiourea |
|---|---|
| PubChem CID | 9090178 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-cyclopentyl-3-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanoylamino]thiourea |
| SMILES | Cc1ccc(-c2nnc(CCC(=O)NNC(=S)NC3CCCC3)o2)cc1 |
| InChI | InChI=1S/C18H23N5O2S/c1-12-6-8-13(9-7-12)17-22-21-16(25-17)11-10-15(24)20-23-18(26)19-14-4-2-3-5-14/h6-9,14H,2-5,10-11H2,1H3,(H,20,24)(H2,19,23,26) |
| InChIKey | NTSYHXCLNLKEJZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|