C17H17ClFN3O2S — CID 9469661
1-[[2-(4-chloro-2,6-dimethylphenoxy)acetyl]amino]-3-(4-fluorophenyl)thiourea (PubChem CID 9469661) has the molecular formula C17H17ClFN3O2S and a molecular weight of 381.86 g/mol. Its IUPAC name is 1-[[2-(4-chloro-2,6-dimethylphenoxy)acetyl]amino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[[2-(4-chloro-2,6-dimethylphenoxy)acetyl]amino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9469661 |
| Molecular Formula | C17H17ClFN3O2S |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-[[2-(4-chloro-2,6-dimethylphenoxy)acetyl]amino]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1cc(Cl)cc(C)c1OCC(=O)NNC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H17ClFN3O2S/c1-10-7-12(18)8-11(2)16(10)24-9-15(23)21-22-17(25)20-14-5-3-13(19)4-6-14/h3-8H,9H2,1-2H3,(H,21,23)(H2,20,22,25) |
| InChIKey | RLNLSJXLKGYJCT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|