C15H11F3N2O3S — CID 17393067
3-hydroxy-N'-[4-(trifluoromethylsulfanyl)benzoyl]benzohydrazide (PubChem CID 17393067) has the molecular formula C15H11F3N2O3S and a molecular weight of 356.33 g/mol. Its IUPAC name is 3-hydroxy-N'-[4-(trifluoromethylsulfanyl)benzoyl]benzohydrazide.
| Compound Name | 3-hydroxy-N'-[4-(trifluoromethylsulfanyl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 17393067 |
| Molecular Formula | C15H11F3N2O3S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 3-hydroxy-N'-[4-(trifluoromethylsulfanyl)benzoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)c1cccc(O)c1)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H11F3N2O3S/c16-15(17,18)24-12-6-4-9(5-7-12)13(22)19-20-14(23)10-2-1-3-11(21)8-10/h1-8,21H,(H,19,22)(H,20,23) |
| InChIKey | CTZAMIWBNVSPOD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|