C9H9NO3 — CID 130011909
N-acetyl-3-hydroxybenzamide (PubChem CID 130011909) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is N-acetyl-3-hydroxybenzamide.
| Compound Name | N-acetyl-3-hydroxybenzamide |
|---|---|
| PubChem CID | 130011909 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | N-acetyl-3-hydroxybenzamide |
| SMILES | CC(=O)NC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C9H9NO3/c1-6(11)10-9(13)7-3-2-4-8(12)5-7/h2-5,12H,1H3,(H,10,11,13) |
| InChIKey | XYJJTDPFPLOPCA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |