C12H15N3O2S — CID 8766861
1-[(3-hydroxybenzoyl)amino]-3-(2-methylprop-2-enyl)thiourea (PubChem CID 8766861) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 1-[(3-hydroxybenzoyl)amino]-3-(2-methylprop-2-enyl)thiourea.
| Compound Name | 1-[(3-hydroxybenzoyl)amino]-3-(2-methylprop-2-enyl)thiourea |
|---|---|
| PubChem CID | 8766861 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-[(3-hydroxybenzoyl)amino]-3-(2-methylprop-2-enyl)thiourea |
| SMILES | C=C(C)CNC(=S)NNC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C12H15N3O2S/c1-8(2)7-13-12(18)15-14-11(17)9-4-3-5-10(16)6-9/h3-6,16H,1,7H2,2H3,(H,14,17)(H2,13,15,18) |
| InChIKey | BWBBKSHFZLPYSE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|