C16H13F3N2O3S — CID 100994103
N'-[2-[4-(trifluoromethylsulfanyl)phenoxy]acetyl]benzohydrazide (PubChem CID 100994103) has the molecular formula C16H13F3N2O3S and a molecular weight of 370.35 g/mol. Its IUPAC name is N'-[2-[4-(trifluoromethylsulfanyl)phenoxy]acetyl]benzohydrazide.
| Compound Name | N'-[2-[4-(trifluoromethylsulfanyl)phenoxy]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 100994103 |
| Molecular Formula | C16H13F3N2O3S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N'-[2-[4-(trifluoromethylsulfanyl)phenoxy]acetyl]benzohydrazide |
| SMILES | O=C(COc1ccc(SC(F)(F)F)cc1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13F3N2O3S/c17-16(18,19)25-13-8-6-12(7-9-13)24-10-14(22)20-21-15(23)11-4-2-1-3-5-11/h1-9H,10H2,(H,20,22)(H,21,23) |
| InChIKey | SCMYQUZGTREVRW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|