C15H10F5NO2S — CID 55742418
N-[3-(difluoromethoxy)phenyl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 55742418) has the molecular formula C15H10F5NO2S and a molecular weight of 363.31 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55742418 |
| Molecular Formula | C15H10F5NO2S |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F5NO2S/c16-14(17)23-11-3-1-2-10(8-11)21-13(22)9-4-6-12(7-5-9)24-15(18,19)20/h1-8,14H,(H,21,22) |
| InChIKey | IEYMXUWXYBGPAR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |