C11H8F2N2O2S2 — CID 71612377
N-[3-(difluoromethoxy)phenyl]-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide (PubChem CID 71612377) has the molecular formula C11H8F2N2O2S2 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71612377 |
| Molecular Formula | C11H8F2N2O2S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)c1csc(=S)[nH]1 |
| InChI | InChI=1S/C11H8F2N2O2S2/c12-10(13)17-7-3-1-2-6(4-7)14-9(16)8-5-19-11(18)15-8/h1-5,10H,(H,14,16)(H,15,18) |
| InChIKey | AEXZGTMTLJYPGT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|