C19H26N2O6S — CID 26007765
[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] (2S)-2-[(4-acetylphenyl)sulfonylamino]propanoate (PubChem CID 26007765) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is [(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] (2S)-2-[(4-acetylphenyl)sulfonylamino]propanoate.
| Compound Name | [(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] (2S)-2-[(4-acetylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 26007765 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] (2S)-2-[(4-acetylphenyl)sulfonylamino]propanoate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N[C@@H](C)C(=O)O[C@@H](C)C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H26N2O6S/c1-13(19(24)27-15(3)18(23)21-11-5-4-6-12-21)20-28(25,26)17-9-7-16(8-10-17)14(2)22/h7-10,13,15,20H,4-6,11-12H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | DTMRHJNVEVVXOC-ZFWWWQNUSA-N |
| XLogP | 1.50 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |