C22H32N2O4 — CID 30798104
[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate (PubChem CID 30798104) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is [(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate.
| Compound Name | [(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 30798104 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] (2S)-2-[(4-tert-butylbenzoyl)amino]propanoate |
| SMILES | C[C@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)O[C@@H](C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H32N2O4/c1-15(21(27)28-16(2)20(26)24-13-7-6-8-14-24)23-19(25)17-9-11-18(12-10-17)22(3,4)5/h9-12,15-16H,6-8,13-14H2,1-5H3,(H,23,25)/t15-,16-/m0/s1 |
| InChIKey | CGWJJJMBGQFLMI-HOTGVXAUSA-N |
| XLogP | 3.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |