C25H38N4O3 — CID 55576443
4-[2-[(4-tert-butylbenzoyl)amino]propanoyl]-N-cyclohexylpiperazine-1-carboxamide (PubChem CID 55576443) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is 4-[2-[(4-tert-butylbenzoyl)amino]propanoyl]-N-cyclohexylpiperazine-1-carboxamide.
| Compound Name | 4-[2-[(4-tert-butylbenzoyl)amino]propanoyl]-N-cyclohexylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 55576443 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 4-[2-[(4-tert-butylbenzoyl)amino]propanoyl]-N-cyclohexylpiperazine-1-carboxamide |
| SMILES | CC(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)N1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C25H38N4O3/c1-18(26-22(30)19-10-12-20(13-11-19)25(2,3)4)23(31)28-14-16-29(17-15-28)24(32)27-21-8-6-5-7-9-21/h10-13,18,21H,5-9,14-17H2,1-4H3,(H,26,30)(H,27,32) |
| InChIKey | ARDUQNKMFMKOTB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |