C30H35F6N5O2 — CID 24718430
2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-pentylamino]-N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]acetamide (PubChem CID 24718430) has the molecular formula C30H35F6N5O2 and a molecular weight of 611.63 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-pentylamino]-N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]acetamide.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-pentylamino]-N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 24718430 |
| Molecular Formula | C30H35F6N5O2 |
| Molecular Weight | 611.63 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-pentylamino]-N-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]acetamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1cccc(C)c1)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H35F6N5O2/c1-6-7-8-12-40(27(43)37-22-15-20(29(31,32)33)14-21(16-22)30(34,35)36)18-26(42)38-25-17-24(28(3,4)5)39-41(25)23-11-9-10-19(2)13-23/h9-11,13-17H,6-8,12,18H2,1-5H3,(H,37,43)(H,38,42) |
| InChIKey | ZEBQPLNJIGDMDE-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.63 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|