C28H35Cl2N5O2 — CID 3872854
N-[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]-2-[(3-methylphenyl)carbamoyl-pentylamino]acetamide (PubChem CID 3872854) has the molecular formula C28H35Cl2N5O2 and a molecular weight of 544.53 g/mol. Its IUPAC name is N-[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]-2-[(3-methylphenyl)carbamoyl-pentylamino]acetamide.
| Compound Name | N-[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]-2-[(3-methylphenyl)carbamoyl-pentylamino]acetamide |
|---|---|
| PubChem CID | 3872854 |
| Molecular Formula | C28H35Cl2N5O2 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | N-[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]-2-[(3-methylphenyl)carbamoyl-pentylamino]acetamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(Cl)c(Cl)c1)C(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C28H35Cl2N5O2/c1-6-7-8-14-34(27(37)31-20-11-9-10-19(2)15-20)18-26(36)32-25-17-24(28(3,4)5)33-35(25)21-12-13-22(29)23(30)16-21/h9-13,15-17H,6-8,14,18H2,1-5H3,(H,31,37)(H,32,36) |
| InChIKey | FVQDBYPWTAMSOX-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|