C25H36Cl2N4O2 — CID 42734872
N-[2-[[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2,2-dimethyl-N-pentylpropanamide (PubChem CID 42734872) has the molecular formula C25H36Cl2N4O2 and a molecular weight of 495.50 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2,2-dimethyl-N-pentylpropanamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2,2-dimethyl-N-pentylpropanamide |
|---|---|
| PubChem CID | 42734872 |
| Molecular Formula | C25H36Cl2N4O2 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2,2-dimethyl-N-pentylpropanamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(Cl)c(Cl)c1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C25H36Cl2N4O2/c1-8-9-10-13-30(23(33)25(5,6)7)16-22(32)28-21-15-20(24(2,3)4)29-31(21)17-11-12-18(26)19(27)14-17/h11-12,14-15H,8-10,13,16H2,1-7H3,(H,28,32) |
| InChIKey | MOUKQDLWCIPWLS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|