C28H31Cl2F3N4O2 — CID 3979360
N-[2-[[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentyl-3-(trifluoromethyl)benzamide (PubChem CID 3979360) has the molecular formula C28H31Cl2F3N4O2 and a molecular weight of 583.48 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3979360 |
| Molecular Formula | C28H31Cl2F3N4O2 |
| Molecular Weight | 583.48 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentyl-3-(trifluoromethyl)benzamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(Cl)c(Cl)c1)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H31Cl2F3N4O2/c1-5-6-7-13-36(26(39)18-9-8-10-19(14-18)28(31,32)33)17-25(38)34-24-16-23(27(2,3)4)35-37(24)20-11-12-21(29)22(30)15-20/h8-12,14-16H,5-7,13,17H2,1-4H3,(H,34,38) |
| InChIKey | RCPQCMFUUBEBHZ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.48 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|