C28H35FN4O2 — CID 42735418
N-[2-[[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-4-fluoro-N-pentylbenzamide (PubChem CID 42735418) has the molecular formula C28H35FN4O2 and a molecular weight of 478.61 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-4-fluoro-N-pentylbenzamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-4-fluoro-N-pentylbenzamide |
|---|---|
| PubChem CID | 42735418 |
| Molecular Formula | C28H35FN4O2 |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-4-fluoro-N-pentylbenzamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1cccc(C)c1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H35FN4O2/c1-6-7-8-16-32(27(35)21-12-14-22(29)15-13-21)19-26(34)30-25-18-24(28(3,4)5)31-33(25)23-11-9-10-20(2)17-23/h9-15,17-18H,6-8,16,19H2,1-5H3,(H,30,34) |
| InChIKey | YQZKTFAFNAVDPG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|