C24H35Cl2N5O2 — CID 42732714
2-[butyl(butylcarbamoyl)amino]-N-[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]acetamide (PubChem CID 42732714) has the molecular formula C24H35Cl2N5O2 and a molecular weight of 496.48 g/mol. Its IUPAC name is 2-[butyl(butylcarbamoyl)amino]-N-[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]acetamide.
| Compound Name | 2-[butyl(butylcarbamoyl)amino]-N-[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 42732714 |
| Molecular Formula | C24H35Cl2N5O2 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 2-[butyl(butylcarbamoyl)amino]-N-[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl]acetamide |
| SMILES | CCCCNC(=O)N(CCCC)CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H35Cl2N5O2/c1-6-8-12-27-23(33)30(13-9-7-2)16-22(32)28-21-15-20(24(3,4)5)29-31(21)17-10-11-18(25)19(26)14-17/h10-11,14-15H,6-9,12-13,16H2,1-5H3,(H,27,33)(H,28,32) |
| InChIKey | XUHFZOLSXOBZGD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|