C28H26FN5O4 — CID 3425130
N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-propylbenzamide (PubChem CID 3425130) has the molecular formula C28H26FN5O4 and a molecular weight of 515.55 g/mol. Its IUPAC name is N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-propylbenzamide.
| Compound Name | N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-propylbenzamide |
|---|---|
| PubChem CID | 3425130 |
| Molecular Formula | C28H26FN5O4 |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-propylbenzamide |
| SMILES | CCCN(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(F)cc1)C(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H26FN5O4/c1-3-15-32(28(36)21-10-9-19(2)25(16-21)34(37)38)18-27(35)30-26-17-24(20-7-5-4-6-8-20)31-33(26)23-13-11-22(29)12-14-23/h4-14,16-17H,3,15,18H2,1-2H3,(H,30,35) |
| InChIKey | NUEYAWTYVQYMRK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|