C26H30Cl2N4O2 — CID 3515023
N-butyl-3-chloro-N-[2-[[1-(2-chlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-2,2-dimethylpropanamide (PubChem CID 3515023) has the molecular formula C26H30Cl2N4O2 and a molecular weight of 501.46 g/mol. Its IUPAC name is N-butyl-3-chloro-N-[2-[[1-(2-chlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-2,2-dimethylpropanamide.
| Compound Name | N-butyl-3-chloro-N-[2-[[1-(2-chlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 3515023 |
| Molecular Formula | C26H30Cl2N4O2 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | N-butyl-3-chloro-N-[2-[[1-(2-chlorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-2,2-dimethylpropanamide |
| SMILES | CCCCN(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccccc1Cl)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C26H30Cl2N4O2/c1-4-5-15-31(25(34)26(2,3)18-27)17-24(33)29-23-16-21(19-11-7-6-8-12-19)30-32(23)22-14-10-9-13-20(22)28/h6-14,16H,4-5,15,17-18H2,1-3H3,(H,29,33) |
| InChIKey | HEHGYVKLCSXTKO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|